cas: 1355170-97-6 — see every product listed under this CAS number, including other names
5-[(tert-butoxy)carbonyl]-4H,5H,6H,7H,8H-pyrazolo[1,5-a][1,4]diazepine-2-carboxylic acid, 97%, 97% (CAS 1355170-97-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HU7U-100mg |
| cas | 1355170-97-6 |
| size | 100mg |
| availability | 300g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 500mg | 443.60 Pln | |
| Chemat | 1g | 587.60 Pln | |
| Chemat | 5g | 1715.60 Pln | |
| Chemat | 10g | 2517.20 Pln | |
| Chemat | 25g | 4197.20 Pln | |
| Chemat | 100g | 10830.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-[(2-methylpropan-2-yl)oxycarbonyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxylic acid (CAS 1355170-97-6) is a chemical compound with the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. IUPAC name: 5-[(2-methylpropan-2-yl)oxycarbonyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxylic acid. InChIKey: BAOVIKKQYWXNLP-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O4 |
|---|---|
| Molecular weight | 281.31 g/mol |
| IUPAC name | 5-[(2-methylpropan-2-yl)oxycarbonyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxylic acid |
| InChIKey | BAOVIKKQYWXNLP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCN2C(=CC(=N2)C(=O)O)C1 |
Computed by PubChem (NCBI)