cas: 59488-81-2 — see every product listed under this CAS number, including other names
5-AMINOTHIENO[2,3-D]PYRIMIDINE-6-CARBOXYLIC ACID (CAS 59488-81-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387048-250MG |
| cas | 59488-81-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 966.34 Pln | |
| Fluorochem | 1g | 2288.80 Pln | |
| Fluorochem | 5g | 7266.21 Pln |
| delivery time | 3-4 weeks |
|---|
5-aminothieno[2,3-d]pyrimidine-6-carboxylic acid (CAS 59488-81-2) is a chemical compound with the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. IUPAC name: 5-aminothieno[2,3-d]pyrimidine-6-carboxylic acid. InChIKey: OZOUSKZJDUDQDW-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 5-aminothieno[2,3-d]pyrimidine-6-carboxylic acid |
| InChIKey | OZOUSKZJDUDQDW-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(SC2=NC=N1)C(=O)O)N |
Computed by PubChem (NCBI)