cas: 20317-25-3 — see every product listed under this CAS number, including other names
5-Amino-1-phenyl-1H-1,2,3-triazole-4-carboxamide, 97% (CAS 20317-25-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A990747-5g |
| cas | 20317-25-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 5909.47 Pln | |
| AmBeed | 10g | 8279.11 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-amino-1-phenyltriazole-4-carboxamide (CAS 20317-25-3) is a chemical compound with the molecular formula C9H9N5O and a molecular weight of 203.20 g/mol. IUPAC name: 5-amino-1-phenyltriazole-4-carboxamide. InChIKey: OHURUUSZJHIVTO-UHFFFAOYSA-N.
| Molecular formula | C9H9N5O |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 5-amino-1-phenyltriazole-4-carboxamide |
| InChIKey | OHURUUSZJHIVTO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=C(N=N2)C(=O)N)N |
Computed by PubChem (NCBI)