CAS 103752-72-3 is the registry number for 5-Amino-2-phenyl-2h-1,2,3-triazole-4-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
5-amino-2-phenyltriazole-4-carboxamide (CAS 103752-72-3) is a chemical compound with the molecular formula C9H9N5O and a molecular weight of 203.20 g/mol. IUPAC name: 5-amino-2-phenyltriazole-4-carboxamide. InChIKey: LLMDNAOXHXCIOB-UHFFFAOYSA-N.
| Molecular formula | C9H9N5O |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 5-amino-2-phenyltriazole-4-carboxamide |
| InChIKey | LLMDNAOXHXCIOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2N=C(C(=N2)N)C(=O)N |
Computed by PubChem (NCBI)