CAS 20317-25-3 appears in our catalog under these names: 5-Amino-1-phenyl-1h-1,2,3-triazole-4-carboxamide, 95%, 5-Amino-1-phenyl-1H-1,2,3-triazole-4-carboxamide, 97%, 5-Amino-1-phenyl-1H-1,2,3-triazole-4-carboxamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 2,5g.
5-amino-1-phenyltriazole-4-carboxamide (CAS 20317-25-3) is a chemical compound with the molecular formula C9H9N5O and a molecular weight of 203.20 g/mol. IUPAC name: 5-amino-1-phenyltriazole-4-carboxamide. InChIKey: OHURUUSZJHIVTO-UHFFFAOYSA-N.
| Molecular formula | C9H9N5O |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 5-amino-1-phenyltriazole-4-carboxamide |
| InChIKey | OHURUUSZJHIVTO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=C(N=N2)C(=O)N)N |
Computed by PubChem (NCBI)