5-Amino-2-methylbenzene-1-sulfonyl fluoride, 95%
cas: 445-06-7 — see every product listed under this CAS number, including other names
5-Amino-2-methylbenzene-1-sulfonyl fluoride, 95% (CAS 445-06-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1090369-100mg |
| cas | 445-06-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 398.19 Pln | |
| Ambeed | 1g | 971.12 Pln | |
| Chemat | 100mg | 386.00 Pln | |
| Chemat | 250mg | 606.80 Pln | |
| Chemat | 1g | 1518.80 Pln | |
| Fluorochem | 1g | 2825.06 Pln | |
| Fluorochem | 100mg | 700.81 Pln | |
| Fluorochem | 250mg | 1117.33 Pln | |
| BLDpharm | 100mg | 314.36 Pln | |
| BLDpharm | 250mg | 425.43 Pln | |
| BLDpharm | 1g | 1041.88 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
5-amino-2-methylbenzenesulfonyl fluoride (CAS 445-06-7) is a chemical compound with the molecular formula C7H8FNO2S and a molecular weight of 189.21 g/mol. IUPAC name: 5-amino-2-methylbenzenesulfonyl fluoride. InChIKey: HHNBKGKQPAGUFL-UHFFFAOYSA-N.
| Molecular formula | C7H8FNO2S |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 5-amino-2-methylbenzenesulfonyl fluoride |
| InChIKey | HHNBKGKQPAGUFL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N)S(=O)(=O)F |
Computed by PubChem (NCBI)