CAS 489-17-8 appears in our catalog under these names: 4-Fluoro-2-methylbenzenesulfonamide 95%, 4-Fluoro-2-methylbenzenesulfonamide, 95%, 95%, 4-Fluoro-2-methylbenzenesulfonamide, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 100mg, 250mg.
4-fluoro-2-methylbenzenesulfonamide (CAS 489-17-8) is a chemical compound with the molecular formula C7H8FNO2S and a molecular weight of 189.21 g/mol. IUPAC name: 4-fluoro-2-methylbenzenesulfonamide. InChIKey: NNYVGGHJPLSSRQ-UHFFFAOYSA-N.
| Molecular formula | C7H8FNO2S |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 4-fluoro-2-methylbenzenesulfonamide |
| InChIKey | NNYVGGHJPLSSRQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)S(=O)(=O)N |
Computed by PubChem (NCBI)