Products 2172163-54-9

CAS 2172163-54-9 is the registry number for 3-Amino-5-methylbenzenesulfonyl fluoride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-amino-5-methylbenzenesulfonyl fluoride (CAS 2172163-54-9) is a chemical compound with the molecular formula C7H8FNO2S and a molecular weight of 189.21 g/mol. IUPAC name: 3-amino-5-methylbenzenesulfonyl fluoride. InChIKey: IQNFFFJNUDMDQI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8FNO2S
Molecular weight189.21 g/mol
IUPAC name3-amino-5-methylbenzenesulfonyl fluoride
InChIKeyIQNFFFJNUDMDQI-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1)S(=O)(=O)F)N

Computed by PubChem (NCBI)