cas: 5294-05-3 — see every product listed under this CAS number, including other names
5-Aminobenzene-1,3-disulfonic acid, 95% (CAS 5294-05-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1159983-25g |
| cas | 5294-05-3 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 14880.25 Pln | |
| AmBeed | 10g | 7178.92 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-aminobenzene-1,3-disulfonic acid (CAS 5294-05-3) is a chemical compound with the molecular formula C6H7NO6S2 and a molecular weight of 253.3 g/mol. IUPAC name: 5-aminobenzene-1,3-disulfonic acid. InChIKey: GBWNQBBVSVGAAL-UHFFFAOYSA-N.
| Molecular formula | C6H7NO6S2 |
|---|---|
| Molecular weight | 253.3 g/mol |
| IUPAC name | 5-aminobenzene-1,3-disulfonic acid |
| InChIKey | GBWNQBBVSVGAAL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1S(=O)(=O)O)S(=O)(=O)O)N |
Computed by PubChem (NCBI)