CAS 137-51-9 appears in our catalog under these names: 4-Amino-1,3-benzenedisulfonic Acid (>90%), Aniline-2,4-disulfonic acid, 4-Aminobenzene-1,3-disulfonic acid 97% (contains ~10%H2O), 1,3-Benzenedisulfonic acid, 4-amino-, 97% (contains ~10%H2O), 97% (contains ~10%H2O), 4-Aminobenzene-1,3-disulfonic acid, 95%. Offered by: TRC, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 500mg, 0,25kg, 0,1kg, 0,5kg, 25kg, 250mg, 1g, 5g.
4-aminobenzene-1,3-disulfonic acid (CAS 137-51-9) is a chemical compound with the molecular formula C6H7NO6S2 and a molecular weight of 253.3 g/mol. IUPAC name: 4-aminobenzene-1,3-disulfonic acid. InChIKey: IMUUNYPYNWXUBO-UHFFFAOYSA-N.
| Molecular formula | C6H7NO6S2 |
|---|---|
| Molecular weight | 253.3 g/mol |
| IUPAC name | 4-aminobenzene-1,3-disulfonic acid |
| InChIKey | IMUUNYPYNWXUBO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)O)S(=O)(=O)O)N |
Computed by PubChem (NCBI)