cas: 86-97-5 — see every product listed under this CAS number, including other names
5-Aminonaphthalen-2-ol, 95%, 95% (CAS 86-97-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MDL-100mg |
| cas | 86-97-5 |
| size | 100mg |
| availability | 171.45g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 270.80 Pln | |
| Chemat | 10g | 405.20 Pln | |
| Chemat | 25g | 750.80 Pln | |
| Chemat | 50g | 1192.40 Pln | |
| Chemat | 100g | 1994.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-aminonaphthalen-2-ol (CAS 86-97-5) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 5-aminonaphthalen-2-ol. InChIKey: FSBRKZMSECKELY-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 5-aminonaphthalen-2-ol |
| InChIKey | FSBRKZMSECKELY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)O)C(=C1)N |
Computed by PubChem (NCBI)