CAS 768404-03-1 appears in our catalog under these names: 5-BDBD/ 99.74% (existing batch purity), 5–BDBD, 5-BDBD, 5-BDBD 97%, 5-BDBD, 97%, 97%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
5-(3-bromophenyl)-1,3-dihydro-[1]benzofuro[3,2-e][1,4]diazepin-2-one (CAS 768404-03-1) is a chemical compound with the molecular formula C17H11BrN2O2 and a molecular weight of 355.2 g/mol. IUPAC name: 5-(3-bromophenyl)-1,3-dihydro-[1]benzofuro[3,2-e][1,4]diazepin-2-one. InChIKey: NKYMVQPXXTZHSF-UHFFFAOYSA-N.
| Molecular formula | C17H11BrN2O2 |
|---|---|
| Molecular weight | 355.2 g/mol |
| IUPAC name | 5-(3-bromophenyl)-1,3-dihydro-[1]benzofuro[3,2-e][1,4]diazepin-2-one |
| InChIKey | NKYMVQPXXTZHSF-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C(=N1)C3=CC(=CC=C3)Br)OC4=CC=CC=C42 |
Computed by PubChem (NCBI)