cas: 1375068-74-8 — see every product listed under this CAS number, including other names
5-BROMO-2-FLUORO-3-NITROTOLUENE, 98% (CAS 1375068-74-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F533041-250MG |
| cas | 1375068-74-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 643.54 Pln | |
| Fluorochem | 10g | 1158.98 Pln | |
| Fluorochem | 25g | 2090.95 Pln | |
| Fluorochem | 100g | 6755.97 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-2-fluoro-1-methyl-3-nitrobenzene (CAS 1375068-74-8) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: 5-bromo-2-fluoro-1-methyl-3-nitrobenzene. InChIKey: DYNFTQDGEFBCPS-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 5-bromo-2-fluoro-1-methyl-3-nitrobenzene |
| InChIKey | DYNFTQDGEFBCPS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1F)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)