cas: 32387-18-1 — see every product listed under this CAS number, including other names
5-BROMO-3-(TRIFLUOROACETYL)INDOLE, 98% (CAS 32387-18-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F501328-1G |
| cas | 32387-18-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 357.18 Pln | |
| Fluorochem | 10g | 643.54 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1-(5-bromo-1H-indol-3-yl)-2,2,2-trifluoroethanone (CAS 32387-18-1) is a chemical compound with the molecular formula C10H5BrF3NO and a molecular weight of 292.05 g/mol. IUPAC name: 1-(5-bromo-1H-indol-3-yl)-2,2,2-trifluoroethanone. InChIKey: DOBUKNJLDXQMFC-UHFFFAOYSA-N.
| Molecular formula | C10H5BrF3NO |
|---|---|
| Molecular weight | 292.05 g/mol |
| IUPAC name | 1-(5-bromo-1H-indol-3-yl)-2,2,2-trifluoroethanone |
| InChIKey | DOBUKNJLDXQMFC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CN2)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)