Products 1630747-25-9
CAS 1630747-25-9 appears in our catalog under these names: 5-[3-Bromo-5-(trifluoromethyl)phenyl]-oxazole, 95%, 5-[3-Bromo-5-(trifluoromethyl)phenyl]-oxazole. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
5-[3-bromo-5-(trifluoromethyl)phenyl]-1,3-oxazole (CAS 1630747-25-9) is a chemical compound with the molecular formula C10H5BrF3NO and a molecular weight of 292.05 g/mol. IUPAC name: 5-[3-bromo-5-(trifluoromethyl)phenyl]-1,3-oxazole. InChIKey: JMKNSRTYWKXRFU-UHFFFAOYSA-N.
| Molecular formula | C10H5BrF3NO |
|---|---|
| Molecular weight | 292.05 g/mol |
| IUPAC name | 5-[3-bromo-5-(trifluoromethyl)phenyl]-1,3-oxazole |
| InChIKey | JMKNSRTYWKXRFU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)Br)C2=CN=CO2 |
Computed by PubChem (NCBI)