Products 1820716-54-8
CAS 1820716-54-8 is the registry number for 1-(7-Bromo-1H-indol-2-yl)-2,2,2-trifluoroethanone, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
1-(7-bromo-1H-indol-2-yl)-2,2,2-trifluoroethanone (CAS 1820716-54-8) is a chemical compound with the molecular formula C10H5BrF3NO and a molecular weight of 292.05 g/mol. IUPAC name: 1-(7-bromo-1H-indol-2-yl)-2,2,2-trifluoroethanone. InChIKey: ULGYKLUHLLIIFE-UHFFFAOYSA-N.
| Molecular formula | C10H5BrF3NO |
|---|---|
| Molecular weight | 292.05 g/mol |
| IUPAC name | 1-(7-bromo-1H-indol-2-yl)-2,2,2-trifluoroethanone |
| InChIKey | ULGYKLUHLLIIFE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)NC(=C2)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)