cas: 1822679-63-9 — see every product listed under this CAS number, including other names
5-BROMO-4-CHLOROISOQUINOLINE, 98% (CAS 1822679-63-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F466956-100MG |
| cas | 1822679-63-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1388.07 Pln | |
| Fluorochem | 250mg | 1919.13 Pln | |
| Fluorochem | 500mg | 3142.66 Pln | |
| Fluorochem | 1g | 3788.27 Pln | |
| Fluorochem | 5g | 12165.53 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-4-chloroisoquinoline (CAS 1822679-63-9) is a chemical compound with the molecular formula C9H5BrClN and a molecular weight of 242.50 g/mol. IUPAC name: 5-bromo-4-chloroisoquinoline. InChIKey: VWZRTGVSAHMYCH-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClN |
|---|---|
| Molecular weight | 242.50 g/mol |
| IUPAC name | 5-bromo-4-chloroisoquinoline |
| InChIKey | VWZRTGVSAHMYCH-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=CC(=C2C(=C1)Br)Cl |
Computed by PubChem (NCBI)