cas: 1822679-63-9 — see every product listed under this CAS number, including other names
5-Bromo-4-chloroisoquinoline, 98%, 98% (CAS 1822679-63-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1134IY-100mg |
| cas | 1822679-63-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 851.60 Pln | |
| Chemat | 250mg | 1346.00 Pln | |
| Chemat | 500mg | 2190.80 Pln | |
| Chemat | 1g | 2637.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-bromo-4-chloroisoquinoline (CAS 1822679-63-9) is a chemical compound with the molecular formula C9H5BrClN and a molecular weight of 242.50 g/mol. IUPAC name: 5-bromo-4-chloroisoquinoline. InChIKey: VWZRTGVSAHMYCH-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClN |
|---|---|
| Molecular weight | 242.50 g/mol |
| IUPAC name | 5-bromo-4-chloroisoquinoline |
| InChIKey | VWZRTGVSAHMYCH-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=CC(=C2C(=C1)Br)Cl |
Computed by PubChem (NCBI)