cas: 1951439-68-1 — see every product listed under this CAS number, including other names
5-Benzyloctahydropyrrolo(3,4-b)pyrrole hydrochloride, 97% (CAS 1951439-68-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A491470-1g |
| cas | 1951439-68-1 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 18258.94 Pln | |
| AmBeed | 250mg | 7660.66 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-benzyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;hydrochloride (CAS 1951439-68-1) is a chemical compound with the molecular formula C13H19ClN2 and a molecular weight of 238.75 g/mol. IUPAC name: 5-benzyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;hydrochloride. InChIKey: BISILDUPJDOPSO-UHFFFAOYSA-N.
| Molecular formula | C13H19ClN2 |
|---|---|
| Molecular weight | 238.75 g/mol |
| IUPAC name | 5-benzyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;hydrochloride |
| InChIKey | BISILDUPJDOPSO-UHFFFAOYSA-N |
| SMILES | C1CNC2C1CN(C2)CC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)