Products 85983-54-6
CAS 85983-54-6 is the registry number for 3-Chloro-4-(3,5-dimethyl-1-piperidinyl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-chloro-4-(3,5-dimethylpiperidin-1-yl)aniline (CAS 85983-54-6) is a chemical compound with the molecular formula C13H19ClN2 and a molecular weight of 238.75 g/mol. IUPAC name: 3-chloro-4-(3,5-dimethylpiperidin-1-yl)aniline. InChIKey: DEZBYVVELTVSTE-UHFFFAOYSA-N.
| Molecular formula | C13H19ClN2 |
|---|---|
| Molecular weight | 238.75 g/mol |
| IUPAC name | 3-chloro-4-(3,5-dimethylpiperidin-1-yl)aniline |
| InChIKey | DEZBYVVELTVSTE-UHFFFAOYSA-N |
| SMILES | CC1CC(CN(C1)C2=C(C=C(C=C2)N)Cl)C |
Computed by PubChem (NCBI)