CAS 1185298-59-2 appears in our catalog under these names: [2-(1,2,6-Trimethyl-1h-indol-3-yl)ethyl]amine hydrochloride, 95%, (2-(1,2,6-Trimethyl-1H-indol-3-yl)ethyl)amine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
2-(1,2,6-trimethylindol-3-yl)ethanamine;hydrochloride (CAS 1185298-59-2) is a chemical compound with the molecular formula C13H19ClN2 and a molecular weight of 238.75 g/mol. IUPAC name: 2-(1,2,6-trimethylindol-3-yl)ethanamine;hydrochloride. InChIKey: MZQZWUIQOGUHEX-UHFFFAOYSA-N.
| Molecular formula | C13H19ClN2 |
|---|---|
| Molecular weight | 238.75 g/mol |
| IUPAC name | 2-(1,2,6-trimethylindol-3-yl)ethanamine;hydrochloride |
| InChIKey | MZQZWUIQOGUHEX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=C(N2C)C)CCN.Cl |
Computed by PubChem (NCBI)