5-Boronoisophthalic acid 97%
cas: 881302-73-4 — see every product listed under this CAS number, including other names
5-Boronoisophthalic acid 97% (CAS 881302-73-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A174621-250mg |
| cas | 881302-73-4 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 142.31 Pln | |
| Ambeed | 5g | 242.44 Pln | |
| Ambeed | 10g | 370.38 Pln | |
| Ambeed | 25g | 437.12 Pln | |
| Ambeed | 100g | 1488.44 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A174621 |
5-boronobenzene-1,3-dicarboxylic acid (CAS 881302-73-4) is a chemical compound with the molecular formula C8H7BO6 and a molecular weight of 209.95 g/mol. IUPAC name: 5-boronobenzene-1,3-dicarboxylic acid. InChIKey: LCDXMCXNZRXUDH-UHFFFAOYSA-N.
| Molecular formula | C8H7BO6 |
|---|---|
| Molecular weight | 209.95 g/mol |
| IUPAC name | 5-boronobenzene-1,3-dicarboxylic acid |
| InChIKey | LCDXMCXNZRXUDH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(=O)O)C(=O)O)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3,5-Dicarboxyphenylboronic acid, 5-boronoisophthalic acid, 3,5-Dicarboxybenzeneboronic acid, 5-boronobenzene-1,3-dicarboxylic acid, 5-boronoisophthalicacid, 3,5-Dicarboxyphenylboronic Acid (contains varying amounts of Anhydride), 1,3-Benzenedicarboxylic acid, 5-borono-, 3,5-Dicarboxyphenylboronic, 3,5-Dicarboxyphenylboronic acid(contains varying amounts of Anhydride)