cas: 855360-86-0 — see every product listed under this CAS number, including other names
5-Bromo-1,10-phenanthroline Monohydrate, 95%, 95% (CAS 855360-86-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G0EP-250mg |
| cas | 855360-86-0 |
| size | 250mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 400.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-1,10-phenanthroline;hydrate (CAS 855360-86-0) is a chemical compound with the molecular formula C12H9BrN2O and a molecular weight of 277.12 g/mol. IUPAC name: 5-bromo-1,10-phenanthroline;hydrate. InChIKey: VTTKUSYSKOIISY-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O |
|---|---|
| Molecular weight | 277.12 g/mol |
| IUPAC name | 5-bromo-1,10-phenanthroline;hydrate |
| InChIKey | VTTKUSYSKOIISY-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C3C=CC=NC3=C2N=C1)Br.O |
Computed by PubChem (NCBI)