cas: 855360-86-0 — see every product listed under this CAS number, including other names
5-Bromo-1,10-phenanthroline hydrate, 95% (CAS 855360-86-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F053984-1G |
| cas | 855360-86-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 591.48 Pln | |
| Fluorochem | 10g | 1122.54 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-1,10-phenanthroline;hydrate (CAS 855360-86-0) is a chemical compound with the molecular formula C12H9BrN2O and a molecular weight of 277.12 g/mol. IUPAC name: 5-bromo-1,10-phenanthroline;hydrate. InChIKey: VTTKUSYSKOIISY-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O |
|---|---|
| Molecular weight | 277.12 g/mol |
| IUPAC name | 5-bromo-1,10-phenanthroline;hydrate |
| InChIKey | VTTKUSYSKOIISY-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C3C=CC=NC3=C2N=C1)Br.O |
Computed by PubChem (NCBI)