CAS 446054-18-8 is the registry number for 5-bromo-1-(methylsulfonyl)indoline, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-1-methylsulfonyl-2,3-dihydroindole (CAS 446054-18-8) is a chemical compound with the molecular formula C9H10BrNO2S and a molecular weight of 276.15 g/mol. IUPAC name: 5-bromo-1-methylsulfonyl-2,3-dihydroindole. InChIKey: KLTSAXZCGBYCPU-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2S |
|---|---|
| Molecular weight | 276.15 g/mol |
| IUPAC name | 5-bromo-1-methylsulfonyl-2,3-dihydroindole |
| InChIKey | KLTSAXZCGBYCPU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCC2=C1C=CC(=C2)Br |
Computed by PubChem (NCBI)