CAS 71703-14-5 appears in our catalog under these names: N-(2-Bromophenyl)-1,3-propanesultam, 97%, 2-(2-Bromophenyl)isothiazolidine 1,1-dioxide, 97%, N-(2-Bromophenyl)-1,3-propanesultam. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 25g, 5g, 2,5g.
2-(2-bromophenyl)-1,2-thiazolidine 1,1-dioxide (CAS 71703-14-5) is a chemical compound with the molecular formula C9H10BrNO2S and a molecular weight of 276.15 g/mol. IUPAC name: 2-(2-bromophenyl)-1,2-thiazolidine 1,1-dioxide. InChIKey: XYPXIGBSXPLFNW-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2S |
|---|---|
| Molecular weight | 276.15 g/mol |
| IUPAC name | 2-(2-bromophenyl)-1,2-thiazolidine 1,1-dioxide |
| InChIKey | XYPXIGBSXPLFNW-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)