CAS 71703-16-7 appears in our catalog under these names: N-(4-Bromophenyl)-1,3-propanesultam, 96%, N-(4-Bromophenyl)-1,3-propanesultam, N-(4-Bromophenyl)-1,3-propanesultam, >95%, >95%, 2-(4-Bromophenyl)isothiazolidine 1,1-dioxide. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g, 2,5g, 250mg, 100mg.
2-(4-bromophenyl)-1,2-thiazolidine 1,1-dioxide (CAS 71703-16-7) is a chemical compound with the molecular formula C9H10BrNO2S and a molecular weight of 276.15 g/mol. IUPAC name: 2-(4-bromophenyl)-1,2-thiazolidine 1,1-dioxide. InChIKey: LYQGSNNXYYJBLO-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2S |
|---|---|
| Molecular weight | 276.15 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1,2-thiazolidine 1,1-dioxide |
| InChIKey | LYQGSNNXYYJBLO-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)