cas: 1807008-13-4 — see every product listed under this CAS number, including other names
5-Bromo-1-fluoro-3-iodo-2-nitrobenzene 95% (CAS 1807008-13-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A329949-100mg |
| cas | 1807008-13-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 559.50 Pln | |
| Ambeed | 250mg | 893.25 Pln | |
| Ambeed | 1g | 2289.44 Pln | |
| Ambeed | 5g | 6739.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A329949 |
5-bromo-1-fluoro-3-iodo-2-nitrobenzene (CAS 1807008-13-4) is a chemical compound with the molecular formula C6H2BrFINO2 and a molecular weight of 345.89 g/mol. IUPAC name: 5-bromo-1-fluoro-3-iodo-2-nitrobenzene. InChIKey: QQFBEHHMRSNUOL-UHFFFAOYSA-N.
| Molecular formula | C6H2BrFINO2 |
|---|---|
| Molecular weight | 345.89 g/mol |
| IUPAC name | 5-bromo-1-fluoro-3-iodo-2-nitrobenzene |
| InChIKey | QQFBEHHMRSNUOL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)[N+](=O)[O-])I)Br |
Computed by PubChem (NCBI)