cas: 221636-18-6 — see every product listed under this CAS number, including other names
5-Bromo-1-phenyl-1H-benzoimidazole, 95% (CAS 221636-18-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076651-5G |
| cas | 221636-18-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 726.85 Pln | |
| Fluorochem | 1g | 206.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-1-phenylbenzimidazole (CAS 221636-18-6) is a chemical compound with the molecular formula C13H9BrN2 and a molecular weight of 273.13 g/mol. IUPAC name: 5-bromo-1-phenylbenzimidazole. InChIKey: OCVMHOYOAZUGSK-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2 |
|---|---|
| Molecular weight | 273.13 g/mol |
| IUPAC name | 5-bromo-1-phenylbenzimidazole |
| InChIKey | OCVMHOYOAZUGSK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=NC3=C2C=CC(=C3)Br |
Computed by PubChem (NCBI)