cas: 96546-77-9 — see every product listed under this CAS number, including other names
5-Bromo-1-tosyl-1H-indole 97% (CAS 96546-77-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A314402-250mg |
| cas | 96546-77-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 375.94 Pln | |
| Ambeed | 5g | 1121.31 Pln | |
| Ambeed | 10g | 1911.19 Pln | |
| Ambeed | 25g | 3763.50 Pln | |
| Ambeed | 100g | 11884.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A314402 |
5-bromo-1-(4-methylphenyl)sulfonylindole (CAS 96546-77-9) is a chemical compound with the molecular formula C15H12BrNO2S and a molecular weight of 350.2 g/mol. IUPAC name: 5-bromo-1-(4-methylphenyl)sulfonylindole. InChIKey: CMQRWXUQAKCCAK-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO2S |
|---|---|
| Molecular weight | 350.2 g/mol |
| IUPAC name | 5-bromo-1-(4-methylphenyl)sulfonylindole |
| InChIKey | CMQRWXUQAKCCAK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C2C=CC(=C3)Br |
Computed by PubChem (NCBI)