cas: 96546-77-9 — see every product listed under this CAS number, including other names
5-Bromo-1-tosyl-1H-indole, 97%, 97% (CAS 96546-77-9) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116TVA-100g |
| cas | 96546-77-9 |
| size | 100g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 9122.00 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 837.20 Pln | |
| Chemat | 10g | 1475.60 Pln | |
| Chemat | 25g | 2891.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-bromo-1-(4-methylphenyl)sulfonylindole (CAS 96546-77-9) is a chemical compound with the molecular formula C15H12BrNO2S and a molecular weight of 350.2 g/mol. IUPAC name: 5-bromo-1-(4-methylphenyl)sulfonylindole. InChIKey: CMQRWXUQAKCCAK-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO2S |
|---|---|
| Molecular weight | 350.2 g/mol |
| IUPAC name | 5-bromo-1-(4-methylphenyl)sulfonylindole |
| InChIKey | CMQRWXUQAKCCAK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C2C=CC(=C3)Br |
Computed by PubChem (NCBI)