CAS 337508-54-0 is the registry number for 2-(Bromomethyl)-1-(phenylsulfonyl)-1H-indole, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
1-(benzenesulfonyl)-2-(bromomethyl)indole (CAS 337508-54-0) is a chemical compound with the molecular formula C15H12BrNO2S and a molecular weight of 350.2 g/mol. IUPAC name: 1-(benzenesulfonyl)-2-(bromomethyl)indole. InChIKey: SYYPBRKVYRCLJS-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO2S |
|---|---|
| Molecular weight | 350.2 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-2-(bromomethyl)indole |
| InChIKey | SYYPBRKVYRCLJS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C3=CC=CC=C3C=C2CBr |
Computed by PubChem (NCBI)