cas: 433922-57-7 — see every product listed under this CAS number, including other names
5-Bromo-2-(1H-pyrazol-1-yl)pyridine (CAS 433922-57-7) is a chemical reagent available from Chemat. Available pack sizes: 2,5g, 250mg, 1g, 5g, 10g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | ISA92257-2,5g |
| cas | 433922-57-7 |
| size | 2,5g |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 2,5g | price on request | |
| Fluorochem | 250mg | 513.38 Pln | |
| Fluorochem | 1g | 976.76 Pln | |
| Fluorochem | 5g | 3725.79 Pln | |
| Fluorochem | 10g | 7266.21 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| purity | No data |
| delivery time | 3-4 weeks |
5-bromo-2-pyrazol-1-ylpyridine (CAS 433922-57-7) is a chemical compound with the molecular formula C8H6BrN3 and a molecular weight of 224.06 g/mol. IUPAC name: 5-bromo-2-pyrazol-1-ylpyridine. InChIKey: AAZVSSMAJOIOOI-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3 |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | 5-bromo-2-pyrazol-1-ylpyridine |
| InChIKey | AAZVSSMAJOIOOI-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)