cas: 433683-47-7 — see every product listed under this CAS number, including other names
5-Bromo-2-(2,2,2-trifluoroethoxy)pyrimidine 95% (CAS 433683-47-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A685182-250mg |
| cas | 433683-47-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 1243.69 Pln | |
| Ambeed | 10g | 2183.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A685182 |
5-bromo-2-(2,2,2-trifluoroethoxy)pyrimidine (CAS 433683-47-7) is a chemical compound with the molecular formula C6H4BrF3N2O and a molecular weight of 257.01 g/mol. IUPAC name: 5-bromo-2-(2,2,2-trifluoroethoxy)pyrimidine. InChIKey: CEPMXQTXQLBEDD-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF3N2O |
|---|---|
| Molecular weight | 257.01 g/mol |
| IUPAC name | 5-bromo-2-(2,2,2-trifluoroethoxy)pyrimidine |
| InChIKey | CEPMXQTXQLBEDD-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)OCC(F)(F)F)Br |
Computed by PubChem (NCBI)