cas: 433683-47-7 — see every product listed under this CAS number, including other names
5-Bromo-2-(2,2,2-trifluoroethoxy)pyrimidine, 98%, 98% (CAS 433683-47-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D9CP-100mg |
| cas | 433683-47-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 986.00 Pln | |
| Chemat | 10g | 1878.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-(2,2,2-trifluoroethoxy)pyrimidine (CAS 433683-47-7) is a chemical compound with the molecular formula C6H4BrF3N2O and a molecular weight of 257.01 g/mol. IUPAC name: 5-bromo-2-(2,2,2-trifluoroethoxy)pyrimidine. InChIKey: CEPMXQTXQLBEDD-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF3N2O |
|---|---|
| Molecular weight | 257.01 g/mol |
| IUPAC name | 5-bromo-2-(2,2,2-trifluoroethoxy)pyrimidine |
| InChIKey | CEPMXQTXQLBEDD-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)OCC(F)(F)F)Br |
Computed by PubChem (NCBI)