cas: 1226063-82-6 — see every product listed under this CAS number, including other names
5-Bromo-2-(pyrrolidin-1-yl)pyridin-3-amine 95+% (CAS 1226063-82-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A878534-100mg |
| cas | 1226063-82-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 375.94 Pln | |
| Ambeed | 250mg | 609.56 Pln | |
| Ambeed | 1g | 1532.94 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A878534 |
5-bromo-2-pyrrolidin-1-ylpyridin-3-amine (CAS 1226063-82-6) is a chemical compound with the molecular formula C9H12BrN3 and a molecular weight of 242.12 g/mol. IUPAC name: 5-bromo-2-pyrrolidin-1-ylpyridin-3-amine. InChIKey: SJQIFANLMKJCOZ-UHFFFAOYSA-N.
| Molecular formula | C9H12BrN3 |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 5-bromo-2-pyrrolidin-1-ylpyridin-3-amine |
| InChIKey | SJQIFANLMKJCOZ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=C(C=C(C=N2)Br)N |
Computed by PubChem (NCBI)