cas: 944904-60-3 — see every product listed under this CAS number, including other names
5-Bromo-2-(trifluoromethyl)isonicotinaldehyde 96% (CAS 944904-60-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A197609-250mg |
| cas | 944904-60-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1616.38 Pln | |
| Ambeed | 25g | 3997.12 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A197609 |
5-bromo-2-(trifluoromethyl)pyridine-4-carbaldehyde (CAS 944904-60-3) is a chemical compound with the molecular formula C7H3BrF3NO and a molecular weight of 254.00 g/mol. IUPAC name: 5-bromo-2-(trifluoromethyl)pyridine-4-carbaldehyde. InChIKey: XCBNWMWTBYJFKY-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3NO |
|---|---|
| Molecular weight | 254.00 g/mol |
| IUPAC name | 5-bromo-2-(trifluoromethyl)pyridine-4-carbaldehyde |
| InChIKey | XCBNWMWTBYJFKY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1C(F)(F)F)Br)C=O |
Computed by PubChem (NCBI)