cas: 126717-60-0 — see every product listed under this CAS number, including other names
5-Bromo-2-benzyloxy-6-methylpyridine, 98%+(LC-MS),RG, 98%+(LC-MS),RG (CAS 126717-60-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111T61-1g |
| cas | 126717-60-0 |
| size | 1g |
| availability | 600g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 25g | 275.60 Pln | |
| Chemat | 100g | 837.20 Pln |
| purity | 98%+(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
3-bromo-2-methyl-6-phenylmethoxypyridine (CAS 126717-60-0) is a chemical compound with the molecular formula C13H12BrNO and a molecular weight of 278.14 g/mol. IUPAC name: 3-bromo-2-methyl-6-phenylmethoxypyridine. InChIKey: RBXCAMWLXQQRPW-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO |
|---|---|
| Molecular weight | 278.14 g/mol |
| IUPAC name | 3-bromo-2-methyl-6-phenylmethoxypyridine |
| InChIKey | RBXCAMWLXQQRPW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)OCC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)