cas: 126717-60-0 — see every product listed under this CAS number, including other names
5-Bromo-2-benzyloxy-6-methylpyridine (CAS 126717-60-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076990-1G |
| cas | 126717-60-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 25g | 424.87 Pln | |
| Fluorochem | 100g | 1356.83 Pln | |
| Fluorochem | 500g | 5485.59 Pln |
| delivery time | 3-4 weeks |
|---|
3-bromo-2-methyl-6-phenylmethoxypyridine (CAS 126717-60-0) is a chemical compound with the molecular formula C13H12BrNO and a molecular weight of 278.14 g/mol. IUPAC name: 3-bromo-2-methyl-6-phenylmethoxypyridine. InChIKey: RBXCAMWLXQQRPW-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO |
|---|---|
| Molecular weight | 278.14 g/mol |
| IUPAC name | 3-bromo-2-methyl-6-phenylmethoxypyridine |
| InChIKey | RBXCAMWLXQQRPW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)OCC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)