cas: 823221-93-8 — see every product listed under this CAS number, including other names
5-Bromo-2-chloro-4-(trifluoromethyl)pyridine, 98%, 98% (CAS 823221-93-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11458G-100mg |
| cas | 823221-93-8 |
| size | 100mg |
| availability | 340.1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 270.80 Pln | |
| Chemat | 10g | 352.40 Pln | |
| Chemat | 25g | 611.60 Pln | |
| Chemat | 50g | 1130.00 Pln | |
| Chemat | 100g | 2128.40 Pln | |
| Chemat | 250g | 4888.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-chloro-4-(trifluoromethyl)pyridine (CAS 823221-93-8) is a chemical compound with the molecular formula C6H2BrClF3N and a molecular weight of 260.44 g/mol. IUPAC name: 5-bromo-2-chloro-4-(trifluoromethyl)pyridine. InChIKey: SYBSBIJPNQAETE-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClF3N |
|---|---|
| Molecular weight | 260.44 g/mol |
| IUPAC name | 5-bromo-2-chloro-4-(trifluoromethyl)pyridine |
| InChIKey | SYBSBIJPNQAETE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)Br)C(F)(F)F |
Computed by PubChem (NCBI)