CAS 886365-31-7 appears in our catalog under these names: 5-Bromo-2-chloroisonicotinic acid, 98%, 98%, 5-Bromo-2-chloro-isonicotinic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 50g, 250g, 500g.
5-bromo-2-chloropyridine-4-carboxylic acid (CAS 886365-31-7) is a chemical compound with the molecular formula C6H3BrClNO2 and a molecular weight of 236.45 g/mol. IUPAC name: 5-bromo-2-chloropyridine-4-carboxylic acid. InChIKey: YRPRNBZLQPBYDS-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO2 |
|---|---|
| Molecular weight | 236.45 g/mol |
| IUPAC name | 5-bromo-2-chloropyridine-4-carboxylic acid |
| InChIKey | YRPRNBZLQPBYDS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)Br)C(=O)O |
Computed by PubChem (NCBI)