Products 1060811-26-8
CAS 1060811-26-8 appears in our catalog under these names: 2-Bromo-6-chloroisonicotinic acid, 95%, 2-Bromo-6-chloroisonicotinic acid, 95+%, 2-Bromo-6-chloroisonicotinic Acid, 2-Bromo-6-chloro-4-pyridinecarboxylic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 2,5g.
2-bromo-6-chloropyridine-4-carboxylic acid (CAS 1060811-26-8) is a chemical compound with the molecular formula C6H3BrClNO2 and a molecular weight of 236.45 g/mol. IUPAC name: 2-bromo-6-chloropyridine-4-carboxylic acid. InChIKey: IBBONDAWVSODCZ-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO2 |
|---|---|
| Molecular weight | 236.45 g/mol |
| IUPAC name | 2-bromo-6-chloropyridine-4-carboxylic acid |
| InChIKey | IBBONDAWVSODCZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1Cl)Br)C(=O)O |
Computed by PubChem (NCBI)