Products 1060805-68-6
CAS 1060805-68-6 appears in our catalog under these names: 4-Bromo-2-chloro-nicotinic acid, 95%, 4-Bromo-2-chloro-nicotinic acid, 4-Bromo-2-chloronicotinic acid 97%, 4-Bromo-2-chloronicotinic acid, 95%, 95%, 4-BROMO-2-CHLORONICOTINIC ACID, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 100mg, 10g, 100g.
4-bromo-2-chloropyridine-3-carboxylic acid (CAS 1060805-68-6) is a chemical compound with the molecular formula C6H3BrClNO2 and a molecular weight of 236.45 g/mol. IUPAC name: 4-bromo-2-chloropyridine-3-carboxylic acid. InChIKey: WXSVIABMUKWVTC-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO2 |
|---|---|
| Molecular weight | 236.45 g/mol |
| IUPAC name | 4-bromo-2-chloropyridine-3-carboxylic acid |
| InChIKey | WXSVIABMUKWVTC-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1Br)C(=O)O)Cl |
Computed by PubChem (NCBI)