5-Bromo-2-chloropyridine 1-oxide, 97%
cas: 889865-43-4 — see every product listed under this CAS number, including other names
5-Bromo-2-chloropyridine 1-oxide, 97% (CAS 889865-43-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A417357-250mg |
| cas | 889865-43-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 837.62 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 702.80 Pln | |
| Chemat | 25g | 2224.40 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 242.16 Pln | |
| BLDpharm | 5g | 897.49 Pln | |
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 5g | 1299.56 Pln | |
| Fluorochem | 1g | 325.94 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5-bromo-2-chloro-1-oxidopyridin-1-ium (CAS 889865-43-4) is a chemical compound with the molecular formula C5H3BrClNO and a molecular weight of 208.44 g/mol. IUPAC name: 5-bromo-2-chloro-1-oxidopyridin-1-ium. InChIKey: ZNOXDBXBFJQERJ-UHFFFAOYSA-N.
| Molecular formula | C5H3BrClNO |
|---|---|
| Molecular weight | 208.44 g/mol |
| IUPAC name | 5-bromo-2-chloro-1-oxidopyridin-1-ium |
| InChIKey | ZNOXDBXBFJQERJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=[N+](C=C1Br)[O-])Cl |
Computed by PubChem (NCBI)