Products 889865-43-4
CAS 889865-43-4 appears in our catalog under these names: 5-Bromo-2-chloropyridine 1-oxide 97%, 5-Bromo-2-chloropyridine 1-oxide, 97%, 97%, 5-Bromo-2-chloropyridine 1-oxide, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
5-bromo-2-chloro-1-oxidopyridin-1-ium (CAS 889865-43-4) is a chemical compound with the molecular formula C5H3BrClNO and a molecular weight of 208.44 g/mol. IUPAC name: 5-bromo-2-chloro-1-oxidopyridin-1-ium. InChIKey: ZNOXDBXBFJQERJ-UHFFFAOYSA-N.
| Molecular formula | C5H3BrClNO |
|---|---|
| Molecular weight | 208.44 g/mol |
| IUPAC name | 5-bromo-2-chloro-1-oxidopyridin-1-ium |
| InChIKey | ZNOXDBXBFJQERJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=[N+](C=C1Br)[O-])Cl |
Computed by PubChem (NCBI)