cas: 393184-78-6 — see every product listed under this CAS number, including other names
5-Bromo-2-ethoxynicotinic acid (CAS 393184-78-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F047371-5G |
| cas | 393184-78-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 3007.29 Pln | |
| Fluorochem | 1g | 1049.65 Pln |
| delivery time | 3-4 weeks |
|---|
5-bromo-2-ethoxypyridine-3-carboxylic acid (CAS 393184-78-6) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 5-bromo-2-ethoxypyridine-3-carboxylic acid. InChIKey: WWLDXHCDXKRRTC-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 5-bromo-2-ethoxypyridine-3-carboxylic acid |
| InChIKey | WWLDXHCDXKRRTC-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=N1)Br)C(=O)O |
Computed by PubChem (NCBI)