5-Bromo-2-fluoro-N,N-dimethylbenzamide, 98%
cas: 188723-78-6 — see every product listed under this CAS number, including other names
5-Bromo-2-fluoro-N,N-dimethylbenzamide, 98% (CAS 188723-78-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g, 1g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1544112-100mg |
| cas | 188723-78-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 453.81 Pln | |
| Ambeed | 5g | 3835.81 Pln | |
| BLDpharm | 100mg | 292.14 Pln | |
| BLDpharm | 250mg | 447.64 Pln | |
| BLDpharm | 1g | 1086.31 Pln | |
| BLDpharm | 5g | 4135.24 Pln | |
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 1178.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
5-bromo-2-fluoro-N,N-dimethylbenzamide (CAS 188723-78-6) is a chemical compound with the molecular formula C9H9BrFNO and a molecular weight of 246.08 g/mol. IUPAC name: 5-bromo-2-fluoro-N,N-dimethylbenzamide. InChIKey: YTOTUMVHMIXIEZ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrFNO |
|---|---|
| Molecular weight | 246.08 g/mol |
| IUPAC name | 5-bromo-2-fluoro-N,N-dimethylbenzamide |
| InChIKey | YTOTUMVHMIXIEZ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=CC(=C1)Br)F |
Computed by PubChem (NCBI)