CAS 2270905-56-9 is the registry number for 4-Bromo-2-fluoro-5,n-dimethyl-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-bromo-2-fluoro-N,5-dimethylbenzamide (CAS 2270905-56-9) is a chemical compound with the molecular formula C9H9BrFNO and a molecular weight of 246.08 g/mol. IUPAC name: 4-bromo-2-fluoro-N,5-dimethylbenzamide. InChIKey: NOMIELIJLPPPIS-UHFFFAOYSA-N.
| Molecular formula | C9H9BrFNO |
|---|---|
| Molecular weight | 246.08 g/mol |
| IUPAC name | 4-bromo-2-fluoro-N,5-dimethylbenzamide |
| InChIKey | NOMIELIJLPPPIS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)F)C(=O)NC |
Computed by PubChem (NCBI)