CAS 1251351-08-2 is the registry number for 4-Bromo-N-ethyl-3-fluorobenzamide, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
4-bromo-N-ethyl-3-fluorobenzamide (CAS 1251351-08-2) is a chemical compound with the molecular formula C9H9BrFNO and a molecular weight of 246.08 g/mol. IUPAC name: 4-bromo-N-ethyl-3-fluorobenzamide. InChIKey: RANSMOUZDHCGGN-UHFFFAOYSA-N.
| Molecular formula | C9H9BrFNO |
|---|---|
| Molecular weight | 246.08 g/mol |
| IUPAC name | 4-bromo-N-ethyl-3-fluorobenzamide |
| InChIKey | RANSMOUZDHCGGN-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=CC(=C(C=C1)Br)F |
Computed by PubChem (NCBI)