cas: 113893-02-0 — see every product listed under this CAS number, including other names
5-Bromo-2-methoxy-4,6-dimethylnicotinonitrile, 96% (CAS 113893-02-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F236812-250MG |
| cas | 113893-02-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 664.37 Pln | |
| Fluorochem | 10g | 1216.26 Pln | |
| Fluorochem | 25g | 2064.92 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-2-methoxy-4,6-dimethylpyridine-3-carbonitrile (CAS 113893-02-0) is a chemical compound with the molecular formula C9H9BrN2O and a molecular weight of 241.08 g/mol. IUPAC name: 5-bromo-2-methoxy-4,6-dimethylpyridine-3-carbonitrile. InChIKey: TVKHQKFOAMVIQV-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 5-bromo-2-methoxy-4,6-dimethylpyridine-3-carbonitrile |
| InChIKey | TVKHQKFOAMVIQV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=C1Br)C)OC)C#N |
Computed by PubChem (NCBI)